C17H13N3O4S — CID 4736041
2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one (PubChem CID 4736041) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is 2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one.
| Compound Name | 2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
|---|---|
| PubChem CID | 4736041 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | 2-[[5-(4-nitrophenyl)furan-2-yl]methylidene]-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-one |
| SMILES | O=c1c(=Cc2ccc(-c3ccc([N+](=O)[O-])cc3)o2)sc2n1CCCN=2 |
| InChI | InChI=1S/C17H13N3O4S/c21-16-15(25-17-18-8-1-9-19(16)17)10-13-6-7-14(24-13)11-2-4-12(5-3-11)20(22)23/h2-7,10H,1,8-9H2 |
| InChIKey | JQJYVIBZTUQZLF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|