C7H13N3O3S — CID 47405494
3-[(dimethylsulfamoylamino)methyl]-5-methyl-1,2-oxazole (PubChem CID 47405494) has the molecular formula C7H13N3O3S and a molecular weight of 219.27 g/mol. Its IUPAC name is 3-[(dimethylsulfamoylamino)methyl]-5-methyl-1,2-oxazole.
| Compound Name | 3-[(dimethylsulfamoylamino)methyl]-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 47405494 |
| Molecular Formula | C7H13N3O3S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3-[(dimethylsulfamoylamino)methyl]-5-methyl-1,2-oxazole |
| SMILES | Cc1cc(CNS(=O)(=O)N(C)C)no1 |
| InChI | InChI=1S/C7H13N3O3S/c1-6-4-7(9-13-6)5-8-14(11,12)10(2)3/h4,8H,5H2,1-3H3 |
| InChIKey | QUFUMZUPWOXEAW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |