C19H25FN2O2+2 — CID 4742427
2-[[4-[(4-fluorophenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-4-methoxyphenol (PubChem CID 4742427) has the molecular formula C19H25FN2O2+2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-[[4-[(4-fluorophenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-4-methoxyphenol.
| Compound Name | 2-[[4-[(4-fluorophenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 4742427 |
| Molecular Formula | C19H25FN2O2+2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-[[4-[(4-fluorophenyl)methyl]piperazine-1,4-diium-1-yl]methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C[NH+]2CC[NH+](Cc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C19H23FN2O2/c1-24-18-6-7-19(23)16(12-18)14-22-10-8-21(9-11-22)13-15-2-4-17(20)5-3-15/h2-7,12,23H,8-11,13-14H2,1H3/p+2 |
| InChIKey | SMMUOYGOTGJEFA-UHFFFAOYSA-P |
| XLogP | 0.02 |
| TPSA | 38.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|