C10H12N4OS — CID 47426149
2-ethyl-N-(1-methylpyrazol-3-yl)-1,3-thiazole-5-carboxamide (PubChem CID 47426149) has the molecular formula C10H12N4OS and a molecular weight of 236.30 g/mol. Its IUPAC name is 2-ethyl-N-(1-methylpyrazol-3-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-ethyl-N-(1-methylpyrazol-3-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 47426149 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 2-ethyl-N-(1-methylpyrazol-3-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)Nc2ccn(C)n2)s1 |
| InChI | InChI=1S/C10H12N4OS/c1-3-9-11-6-7(16-9)10(15)12-8-4-5-14(2)13-8/h4-6H,3H2,1-2H3,(H,12,13,15) |
| InChIKey | VBTCKGIDCJIDBL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |