C15H14FN2O+ — CID 4744505
2-(3-fluoro-4-methoxyphenyl)-8-methyl-1H-imidazo[1,2-a]pyridin-4-ium (PubChem CID 4744505) has the molecular formula C15H14FN2O+ and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-8-methyl-1H-imidazo[1,2-a]pyridin-4-ium.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-8-methyl-1H-imidazo[1,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 4744505 |
| Molecular Formula | C15H14FN2O+ |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-8-methyl-1H-imidazo[1,2-a]pyridin-4-ium |
| SMILES | COc1ccc(-c2c[n+]3cccc(C)c3[nH]2)cc1F |
| InChI | InChI=1S/C15H13FN2O/c1-10-4-3-7-18-9-13(17-15(10)18)11-5-6-14(19-2)12(16)8-11/h3-9H,1-2H3/p+1 |
| InChIKey | IZWGAOFKZCCRIH-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 29.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|