C14H22N3O2+ — CID 4744636
5-methyl-N'-(1-propan-2-yl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)furan-2-carbohydrazide (PubChem CID 4744636) has the molecular formula C14H22N3O2+ and a molecular weight of 264.35 g/mol. Its IUPAC name is 5-methyl-N'-(1-propan-2-yl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)furan-2-carbohydrazide.
| Compound Name | 5-methyl-N'-(1-propan-2-yl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 4744636 |
| Molecular Formula | C14H22N3O2+ |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5-methyl-N'-(1-propan-2-yl-1,2,3,6-tetrahydropyridin-1-ium-4-yl)furan-2-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC2=CC[NH+](C(C)C)CC2)o1 |
| InChI | InChI=1S/C14H21N3O2/c1-10(2)17-8-6-12(7-9-17)15-16-14(18)13-5-4-11(3)19-13/h4-6,10,15H,7-9H2,1-3H3,(H,16,18)/p+1 |
| InChIKey | MMWLNCIMMLQKJV-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 58.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|