C14H16BrClN2O — CID 47447532
N-[(4-bromo-2-chlorophenyl)methyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 47447532) has the molecular formula C14H16BrClN2O and a molecular weight of 343.65 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 47447532 |
| Molecular Formula | C14H16BrClN2O |
| Molecular Weight | 343.65 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-2-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(NCc1ccc(Br)cc1Cl)N1CC2CCC1C2 |
| InChI | InChI=1S/C14H16BrClN2O/c15-11-3-2-10(13(16)6-11)7-17-14(19)18-8-9-1-4-12(18)5-9/h2-3,6,9,12H,1,4-5,7-8H2,(H,17,19) |
| InChIKey | FVDMGFFLPFJCGV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |