About 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile
2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile (PubChem CID 4746423) has the molecular formula C14H13N6OS+
and a molecular weight of 313.37 g/mol. Its IUPAC name is 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile |
| PubChem CID | 4746423 |
| Molecular Formula | C14H13N6OS+ |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile |
| SMILES | Cc1cc(C)n(C(=O)CSc2[nH+]c(N)c(C#N)cc2C#N)n1 |
| InChI | InChI=1S/C14H12N6OS/c1-8-3-9(2)20(19-8)12(21)7-22-14-11(6-16)4-10(5-15)13(17)18-14/h3-4H,7H2,1-2H3,(H2,17,18)/p+1 |
| InChIKey | FHDQMKKXHZPVLV-UHFFFAOYSA-O |
| XLogP | 1.07 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile?
The IUPAC name of 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile (CID 4746423) is 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile.
What is the SMILES notation for 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile?
The canonical SMILES for 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile is Cc1cc(C)n(C(=O)CSc2[nH+]c(N)c(C#N)cc2C#N)n1.
What is the InChIKey of 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile?
The InChIKey is FHDQMKKXHZPVLV-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H12N6OS/c1-8-3-9(2)20(19-8)12(21)7-22-14-11(6-16)4-10(5-15)13(17)18-14/h3-4H,7H2,1-2H3,(H2,17,18)/p+1.
What are the key properties of 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile?
2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile has a molecular weight of 313.37 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-[2-(3,5-dimethylpyrazol-1-yl)-2-oxoethyl]sulfanylpyridin-1-ium-3,5-dicarbonitrile is sourced from PubChem (CID 4746423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).