About (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide
(2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide (PubChem CID 8637943) has the molecular formula C12H14N5OS+
and a molecular weight of 276.35 g/mol. Its IUPAC name is (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide.
Molecular Properties
| Compound Name | (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide |
| PubChem CID | 8637943 |
| Molecular Formula | C12H14N5OS+ |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide |
| SMILES | CCNC(=O)[C@@H](C)Sc1[nH+]c(N)c(C#N)cc1C#N |
| InChI | InChI=1S/C12H13N5OS/c1-3-16-11(18)7(2)19-12-9(6-14)4-8(5-13)10(15)17-12/h4,7H,3H2,1-2H3,(H2,15,17)(H,16,18)/p+1/t7-/m1/s1 |
| InChIKey | VTVGBVVQCCVUCH-SSDOTTSWSA-O |
| XLogP | 0.44 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide?
The IUPAC name of (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide (CID 8637943) is (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide.
What is the SMILES notation for (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide?
The canonical SMILES for (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide is CCNC(=O)[C@@H](C)Sc1[nH+]c(N)c(C#N)cc1C#N.
What is the InChIKey of (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide?
The InChIKey is VTVGBVVQCCVUCH-SSDOTTSWSA-O. The full InChI is InChI=1S/C12H13N5OS/c1-3-16-11(18)7(2)19-12-9(6-14)4-8(5-13)10(15)17-12/h4,7H,3H2,1-2H3,(H2,15,17)(H,16,18)/p+1/t7-/m1/s1.
What are the key properties of (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide?
(2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide has a molecular weight of 276.35 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(6-amino-3,5-dicyanopyridin-1-ium-2-yl)sulfanyl-N-ethylpropanamide is sourced from PubChem (CID 8637943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).