C21H17N2OS+ — CID 4746454
1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-yl)ethanone (PubChem CID 4746454) has the molecular formula C21H17N2OS+ and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-yl)ethanone.
| Compound Name | 1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 4746454 |
| Molecular Formula | C21H17N2OS+ |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-yl)ethanone |
| SMILES | CC(=O)c1sc2[nH+]c(-c3ccccc3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C21H16N2OS/c1-13(24)20-19(22)18-16(14-8-4-2-5-9-14)12-17(23-21(18)25-20)15-10-6-3-7-11-15/h2-12H,22H2,1H3/p+1 |
| InChIKey | DECAZZLVVPAGES-UHFFFAOYSA-O |
| XLogP | 4.83 |
| TPSA | 57.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |