C22H19N2O2S+ — CID 4753619
ethyl 3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-carboxylate (PubChem CID 4753619) has the molecular formula C22H19N2O2S+ and a molecular weight of 375.47 g/mol. Its IUPAC name is ethyl 3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-carboxylate.
| Compound Name | ethyl 3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-carboxylate |
|---|---|
| PubChem CID | 4753619 |
| Molecular Formula | C22H19N2O2S+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | ethyl 3-amino-4,6-diphenylthieno[2,3-b]pyridin-7-ium-2-carboxylate |
| SMILES | CCOC(=O)c1sc2[nH+]c(-c3ccccc3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C22H18N2O2S/c1-2-26-22(25)20-19(23)18-16(14-9-5-3-6-10-14)13-17(24-21(18)27-20)15-11-7-4-8-12-15/h3-13H,2,23H2,1H3/p+1 |
| InChIKey | TXLKVSMOZZXCTK-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 66.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |