C15H12N2O2S2 — CID 57149764
1-(3,4-diamino-5-benzoylthieno[2,3-b]thiophen-2-yl)ethanone (PubChem CID 57149764) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-(3,4-diamino-5-benzoylthieno[2,3-b]thiophen-2-yl)ethanone.
| Compound Name | 1-(3,4-diamino-5-benzoylthieno[2,3-b]thiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 57149764 |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 1-(3,4-diamino-5-benzoylthieno[2,3-b]thiophen-2-yl)ethanone |
| SMILES | CC(=O)c1sc2sc(C(=O)c3ccccc3)c(N)c2c1N |
| InChI | InChI=1S/C15H12N2O2S2/c1-7(18)13-10(16)9-11(17)14(21-15(9)20-13)12(19)8-5-3-2-4-6-8/h2-6H,16-17H2,1H3 |
| InChIKey | GPQJFJNROIJGTO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |