C20H21N3OS2 — CID 10833863
[4-amino-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]thiophen-5-yl]-phenylmethanone (PubChem CID 10833863) has the molecular formula C20H21N3OS2 and a molecular weight of 383.54 g/mol. Its IUPAC name is [4-amino-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]thiophen-5-yl]-phenylmethanone.
| Compound Name | [4-amino-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]thiophen-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10833863 |
| Molecular Formula | C20H21N3OS2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | [4-amino-3-(1-piperidin-1-ylethylideneamino)thieno[2,3-b]thiophen-5-yl]-phenylmethanone |
| SMILES | C/C(=N\c1csc2sc(C(=O)c3ccccc3)c(N)c12)N1CCCCC1 |
| InChI | InChI=1S/C20H21N3OS2/c1-13(23-10-6-3-7-11-23)22-15-12-25-20-16(15)17(21)19(26-20)18(24)14-8-4-2-5-9-14/h2,4-5,8-9,12H,3,6-7,10-11,21H2,1H3/b22-13+ |
| InChIKey | CVIQOWIZUYUDGW-LPYMAVHISA-N |
| XLogP | 5.31 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|