C18H18N3O2S+ — CID 4746608
phenyl 3-amino-6-methyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-carboxylate (PubChem CID 4746608) has the molecular formula C18H18N3O2S+ and a molecular weight of 340.43 g/mol. Its IUPAC name is phenyl 3-amino-6-methyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-carboxylate.
| Compound Name | phenyl 3-amino-6-methyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-carboxylate |
|---|---|
| PubChem CID | 4746608 |
| Molecular Formula | C18H18N3O2S+ |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | phenyl 3-amino-6-methyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-carboxylate |
| SMILES | C[NH+]1CCc2nc3sc(C(=O)Oc4ccccc4)c(N)c3cc2C1 |
| InChI | InChI=1S/C18H17N3O2S/c1-21-8-7-14-11(10-21)9-13-15(19)16(24-17(13)20-14)18(22)23-12-5-3-2-4-6-12/h2-6,9H,7-8,10,19H2,1H3/p+1 |
| InChIKey | QLTVPZRLTYHNII-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|