C22H25N4OS+ — CID 7298185
(3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone (PubChem CID 7298185) has the molecular formula C22H25N4OS+ and a molecular weight of 393.54 g/mol. Its IUPAC name is (3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone.
| Compound Name | (3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
|---|---|
| PubChem CID | 7298185 |
| Molecular Formula | C22H25N4OS+ |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3-amino-6-ethyl-5,6,7,8-tetrahydrothieno[2,3-b][1,6]naphthyridin-6-ium-2-yl)-(3,4-dihydro-1H-isoquinolin-2-yl)methanone |
| SMILES | CC[NH+]1CCc2nc3sc(C(=O)N4CCc5ccccc5C4)c(N)c3cc2C1 |
| InChI | InChI=1S/C22H24N4OS/c1-2-25-9-8-18-16(12-25)11-17-19(23)20(28-21(17)24-18)22(27)26-10-7-14-5-3-4-6-15(14)13-26/h3-6,11H,2,7-10,12-13,23H2,1H3/p+1 |
| InChIKey | WUCKZOSKFXRLQN-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 63.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |