C13H15NO4S — CID 47468524
N-(furan-2-ylmethyl)-1,1-dioxo-N-prop-2-ynylthiolane-3-carboxamide (PubChem CID 47468524) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,1-dioxo-N-prop-2-ynylthiolane-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1,1-dioxo-N-prop-2-ynylthiolane-3-carboxamide |
|---|---|
| PubChem CID | 47468524 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,1-dioxo-N-prop-2-ynylthiolane-3-carboxamide |
| SMILES | C#CCN(Cc1ccco1)C(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15NO4S/c1-2-6-14(9-12-4-3-7-18-12)13(15)11-5-8-19(16,17)10-11/h1,3-4,7,11H,5-6,8-10H2 |
| InChIKey | QEPRMJZVDUFNLE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|