C10H12BrN3O2 — CID 47478452
4-bromo-N-(2-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide (PubChem CID 47478452) has the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is 4-bromo-N-(2-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(2-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 47478452 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 4-bromo-N-(2-oxopiperidin-3-yl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NC1CCCNC1=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C10H12BrN3O2/c11-6-4-8(13-5-6)10(16)14-7-2-1-3-12-9(7)15/h4-5,7,13H,1-3H2,(H,12,15)(H,14,16) |
| InChIKey | DUUYBQFYEVXBRM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |