C12H16BrN3O2 — CID 62093648
4-bromo-1-ethyl-N-(2-oxopiperidin-3-yl)pyrrole-2-carboxamide (PubChem CID 62093648) has the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-(2-oxopiperidin-3-yl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-(2-oxopiperidin-3-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 62093648 |
| Molecular Formula | C12H16BrN3O2 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-bromo-1-ethyl-N-(2-oxopiperidin-3-yl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(Br)cc1C(=O)NC1CCCNC1=O |
| InChI | InChI=1S/C12H16BrN3O2/c1-2-16-7-8(13)6-10(16)12(18)15-9-4-3-5-14-11(9)17/h6-7,9H,2-5H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | FNVBQIUZUCRORG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |