C18H18N4OS2 — CID 4750781
N-(2,3-dimethylphenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide (PubChem CID 4750781) has the molecular formula C18H18N4OS2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide |
|---|---|
| PubChem CID | 4750781 |
| Molecular Formula | C18H18N4OS2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide |
| SMILES | Cc1cccc(NC(=O)CN(c2ccccc2)c2n[nH]c(=S)s2)c1C |
| InChI | InChI=1S/C18H18N4OS2/c1-12-7-6-10-15(13(12)2)19-16(23)11-22(14-8-4-3-5-9-14)17-20-21-18(24)25-17/h3-10H,11H2,1-2H3,(H,19,23)(H,21,24) |
| InChIKey | BCOQHOWMPVJPRH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|