C16H12Cl2N4OS2 — CID 4750980
N-(2,5-dichlorophenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide (PubChem CID 4750980) has the molecular formula C16H12Cl2N4OS2 and a molecular weight of 411.34 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide |
|---|---|
| PubChem CID | 4750980 |
| Molecular Formula | C16H12Cl2N4OS2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide |
| SMILES | O=C(CN(c1ccccc1)c1n[nH]c(=S)s1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H12Cl2N4OS2/c17-10-6-7-12(18)13(8-10)19-14(23)9-22(11-4-2-1-3-5-11)15-20-21-16(24)25-15/h1-8H,9H2,(H,19,23)(H,21,24) |
| InChIKey | YSAJBFNWSIHYIT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|