C17H14Cl2N4O2S2 — CID 4751146
N-(2,5-dichlorophenyl)-2-(4-methoxy-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide (PubChem CID 4751146) has the molecular formula C17H14Cl2N4O2S2 and a molecular weight of 441.37 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-(4-methoxy-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-(4-methoxy-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide |
|---|---|
| PubChem CID | 4751146 |
| Molecular Formula | C17H14Cl2N4O2S2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-(4-methoxy-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)anilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)Nc2cc(Cl)ccc2Cl)c2n[nH]c(=S)s2)cc1 |
| InChI | InChI=1S/C17H14Cl2N4O2S2/c1-25-12-5-3-11(4-6-12)23(16-21-22-17(26)27-16)9-15(24)20-14-8-10(18)2-7-13(14)19/h2-8H,9H2,1H3,(H,20,24)(H,22,26) |
| InChIKey | VNUWFFBENWJANI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|