C15H14N2O4 — CID 4753231
2-[3-acetyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetonitrile (PubChem CID 4753231) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-[3-acetyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetonitrile.
| Compound Name | 2-[3-acetyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 4753231 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[3-acetyl-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]acetonitrile |
| SMILES | COc1ccc(C2C(C(C)=O)C(=O)C(=O)N2CC#N)cc1 |
| InChI | InChI=1S/C15H14N2O4/c1-9(18)12-13(10-3-5-11(21-2)6-4-10)17(8-7-16)15(20)14(12)19/h3-6,12-13H,8H2,1-2H3 |
| InChIKey | ZQQHYGCBAOAGHV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|