C20H29N3O2S — CID 47548219
N-[1-[2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl]piperidin-4-yl]thiophene-2-carboxamide (PubChem CID 47548219) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-[1-[2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl]piperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl]piperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 47548219 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[1-[2-[cyclohexen-1-yl(ethyl)amino]-2-oxoethyl]piperidin-4-yl]thiophene-2-carboxamide |
| SMILES | CCN(C(=O)CN1CCC(NC(=O)c2cccs2)CC1)C1=CCCCC1 |
| InChI | InChI=1S/C20H29N3O2S/c1-2-23(17-7-4-3-5-8-17)19(24)15-22-12-10-16(11-13-22)21-20(25)18-9-6-14-26-18/h6-7,9,14,16H,2-5,8,10-13,15H2,1H3,(H,21,25) |
| InChIKey | VKZWOPNSVVVHAK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |