C17H19F2NO4S — CID 47551164
phenyl 2-[[3-(difluoromethoxy)phenyl]methyl-methylamino]ethanesulfonate (PubChem CID 47551164) has the molecular formula C17H19F2NO4S and a molecular weight of 371.41 g/mol. Its IUPAC name is phenyl 2-[[3-(difluoromethoxy)phenyl]methyl-methylamino]ethanesulfonate.
| Compound Name | phenyl 2-[[3-(difluoromethoxy)phenyl]methyl-methylamino]ethanesulfonate |
|---|---|
| PubChem CID | 47551164 |
| Molecular Formula | C17H19F2NO4S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | phenyl 2-[[3-(difluoromethoxy)phenyl]methyl-methylamino]ethanesulfonate |
| SMILES | CN(CCS(=O)(=O)Oc1ccccc1)Cc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C17H19F2NO4S/c1-20(13-14-6-5-9-16(12-14)23-17(18)19)10-11-25(21,22)24-15-7-3-2-4-8-15/h2-9,12,17H,10-11,13H2,1H3 |
| InChIKey | JHNFCDMASQWASH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|