C15H23F2NO2 — CID 59028589
N-[[3-(difluoromethoxy)phenyl]methyl]-N-(2-methoxyethyl)-2-methylpropan-2-amine (PubChem CID 59028589) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-N-(2-methoxyethyl)-2-methylpropan-2-amine.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-N-(2-methoxyethyl)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 59028589 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-N-(2-methoxyethyl)-2-methylpropan-2-amine |
| SMILES | COCCN(Cc1cccc(OC(F)F)c1)C(C)(C)C |
| InChI | InChI=1S/C15H23F2NO2/c1-15(2,3)18(8-9-19-4)11-12-6-5-7-13(10-12)20-14(16)17/h5-7,10,14H,8-9,11H2,1-4H3 |
| InChIKey | NKNMHFVXPUIRJG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |