C25H30N2O6 — CID 4758228
5-(2,3-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-(4-methoxy-3-methylbenzoyl)pyrrolidine-2,3-dione (PubChem CID 4758228) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-(4-methoxy-3-methylbenzoyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(2,3-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-(4-methoxy-3-methylbenzoyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4758228 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-1-[2-(dimethylamino)ethyl]-4-(4-methoxy-3-methylbenzoyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(=O)C2C(=O)C(=O)N(CCN(C)C)C2c2cccc(OC)c2OC)cc1C |
| InChI | InChI=1S/C25H30N2O6/c1-15-14-16(10-11-18(15)31-4)22(28)20-21(17-8-7-9-19(32-5)24(17)33-6)27(13-12-26(2)3)25(30)23(20)29/h7-11,14,20-21H,12-13H2,1-6H3 |
| InChIKey | OCJUSFPOARESAA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|