C19H24ClN3O3 — CID 47591460
[4-(ethylcarbamoylamino)cyclohexyl] 2-(6-chloroindol-1-yl)acetate (PubChem CID 47591460) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is [4-(ethylcarbamoylamino)cyclohexyl] 2-(6-chloroindol-1-yl)acetate.
| Compound Name | [4-(ethylcarbamoylamino)cyclohexyl] 2-(6-chloroindol-1-yl)acetate |
|---|---|
| PubChem CID | 47591460 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | [4-(ethylcarbamoylamino)cyclohexyl] 2-(6-chloroindol-1-yl)acetate |
| SMILES | CCNC(=O)NC1CCC(OC(=O)Cn2ccc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-2-21-19(25)22-15-5-7-16(8-6-15)26-18(24)12-23-10-9-13-3-4-14(20)11-17(13)23/h3-4,9-11,15-16H,2,5-8,12H2,1H3,(H2,21,22,25) |
| InChIKey | ZKOMFHXWFFXBQB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |