C23H19FN4O3S — CID 4761869
5-(1-acetyl-2-oxoindol-3-ylidene)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 4761869) has the molecular formula C23H19FN4O3S and a molecular weight of 450.50 g/mol. Its IUPAC name is 5-(1-acetyl-2-oxoindol-3-ylidene)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | 5-(1-acetyl-2-oxoindol-3-ylidene)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 4761869 |
| Molecular Formula | C23H19FN4O3S |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 5-(1-acetyl-2-oxoindol-3-ylidene)-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | CC(=O)N1C(=O)C(=C2SC(N3CCN(c4ccccc4F)CC3)=NC2=O)c2ccccc21 |
| InChI | InChI=1S/C23H19FN4O3S/c1-14(29)28-17-8-4-2-6-15(17)19(22(28)31)20-21(30)25-23(32-20)27-12-10-26(11-13-27)18-9-5-3-7-16(18)24/h2-9H,10-13H2,1H3 |
| InChIKey | RAXCFJUKOIUXBD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|