C16H15IN4O3S — CID 4765478
N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 4765478) has the molecular formula C16H15IN4O3S and a molecular weight of 470.29 g/mol. Its IUPAC name is N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4765478 |
| Molecular Formula | C16H15IN4O3S |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | N-[4-(2,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | COc1ccc(OC)c(-c2csc(NC(=O)c3nn(C)cc3I)n2)c1 |
| InChI | InChI=1S/C16H15IN4O3S/c1-21-7-11(17)14(20-21)15(22)19-16-18-12(8-25-16)10-6-9(23-2)4-5-13(10)24-3/h4-8H,1-3H3,(H,18,19,22) |
| InChIKey | RQYSHAIBEWFAGK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|