About Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl-
Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl- (PubChem CID 47677) has the molecular formula C12H20N2
and a molecular weight of 192.30 g/mol. Its IUPAC name is 3-(2-methyl-5,6,7,8-tetrahydroindolizin-3-yl)propan-1-amine.
Analyze Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl-?
The IUPAC name of Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl- (CID 47677) is 3-(2-methyl-5,6,7,8-tetrahydroindolizin-3-yl)propan-1-amine.
What is the SMILES notation for Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl-?
The canonical SMILES for Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl- is CC1=C(N2CCCCC2=C1)CCCN.
What is the InChIKey of Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl-?
The InChIKey is QSCXQARXOXYHOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-10-9-11-5-2-3-8-14(11)12(10)6-4-7-13/h9H,2-8,13H2,1H3.
What are the key properties of Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl-?
Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl- has a molecular weight of 192.30 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Indolizine, 5,6,7,8-tetrahydro-3-(3-aminopropyl)-2-methyl- is sourced from PubChem (CID 47677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).