C16H19N3O4S2 — CID 47723403
2-tert-butyl-N'-(4-methylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 47723403) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-tert-butyl-N'-(4-methylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-tert-butyl-N'-(4-methylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 47723403 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-tert-butyl-N'-(4-methylsulfonylbenzoyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | CC(C)(C)c1ncc(C(=O)NNC(=O)c2ccc(S(C)(=O)=O)cc2)s1 |
| InChI | InChI=1S/C16H19N3O4S2/c1-16(2,3)15-17-9-12(24-15)14(21)19-18-13(20)10-5-7-11(8-6-10)25(4,22)23/h5-9H,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | VSGFYWOENVATNU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|