C13H12N4O3S2 — CID 4773497
6-ethoxy-2-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,3-benzothiazole (PubChem CID 4773497) has the molecular formula C13H12N4O3S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 6-ethoxy-2-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,3-benzothiazole.
| Compound Name | 6-ethoxy-2-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 4773497 |
| Molecular Formula | C13H12N4O3S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 6-ethoxy-2-[(4-nitropyrazol-1-yl)methylsulfanyl]-1,3-benzothiazole |
| SMILES | CCOc1ccc2nc(SCn3cc([N+](=O)[O-])cn3)sc2c1 |
| InChI | InChI=1S/C13H12N4O3S2/c1-2-20-10-3-4-11-12(5-10)22-13(15-11)21-8-16-7-9(6-14-16)17(18)19/h3-7H,2,8H2,1H3 |
| InChIKey | ONJPDZGHSIGACW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|