C21H18N4O — CID 4774218
4-[(1,3-dimethylpyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 4774218) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-[(1,3-dimethylpyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | 4-[(1,3-dimethylpyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 4774218 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 4-[(1,3-dimethylpyrazol-4-yl)methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | Cc1nn(C)cc1C=C1C(=O)N(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C21H18N4O/c1-15-17(14-24(2)22-15)13-19-20(16-9-5-3-6-10-16)23-25(21(19)26)18-11-7-4-8-12-18/h3-14H,1-2H3 |
| InChIKey | PQHUVIRKYOCRNQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|