C10H12F2N6S — CID 4775535
3-(difluoromethyl)-4-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4775535) has the molecular formula C10H12F2N6S and a molecular weight of 286.31 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(difluoromethyl)-4-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4775535 |
| Molecular Formula | C10H12F2N6S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-(difluoromethyl)-4-[(1,3,5-trimethylpyrazol-4-yl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nn(C)c(C)c1C=Nn1c(C(F)F)n[nH]c1=S |
| InChI | InChI=1S/C10H12F2N6S/c1-5-7(6(2)17(3)16-5)4-13-18-9(8(11)12)14-15-10(18)19/h4,8H,1-3H3,(H,15,19) |
| InChIKey | UNKRYJKFDKRVOC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|