C15H10BrClF2N4O2S — CID 4775818
4-[[5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4775818) has the molecular formula C15H10BrClF2N4O2S and a molecular weight of 463.69 g/mol. Its IUPAC name is 4-[[5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4775818 |
| Molecular Formula | C15H10BrClF2N4O2S |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | 4-[[5-[(4-bromo-2-chlorophenoxy)methyl]furan-2-yl]methylideneamino]-3-(difluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | FC(F)c1n[nH]c(=S)n1N=Cc1ccc(COc2ccc(Br)cc2Cl)o1 |
| InChI | InChI=1S/C15H10BrClF2N4O2S/c16-8-1-4-12(11(17)5-8)24-7-10-3-2-9(25-10)6-20-23-14(13(18)19)21-22-15(23)26/h1-6,13H,7H2,(H,22,26) |
| InChIKey | NFAJKFZWOOGKFF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|