C13H15N5S — CID 47770852
2-[(5-tert-butyltetrazol-1-yl)methyl]-1,3-benzothiazole (PubChem CID 47770852) has the molecular formula C13H15N5S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-[(5-tert-butyltetrazol-1-yl)methyl]-1,3-benzothiazole.
| Compound Name | 2-[(5-tert-butyltetrazol-1-yl)methyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 47770852 |
| Molecular Formula | C13H15N5S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[(5-tert-butyltetrazol-1-yl)methyl]-1,3-benzothiazole |
| SMILES | CC(C)(C)c1nnnn1Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H15N5S/c1-13(2,3)12-15-16-17-18(12)8-11-14-9-6-4-5-7-10(9)19-11/h4-7H,8H2,1-3H3 |
| InChIKey | VZKHVZJJNZJEKU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |