C17H16BN3OS2 — CID 157185275
3-(1,3-benzothiazol-2-ylmethyl)-1-(dimethylboranylmethyl)thieno[3,4-d]pyridazin-4-one (PubChem CID 157185275) has the molecular formula C17H16BN3OS2 and a molecular weight of 353.28 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylmethyl)-1-(dimethylboranylmethyl)thieno[3,4-d]pyridazin-4-one.
| Compound Name | 3-(1,3-benzothiazol-2-ylmethyl)-1-(dimethylboranylmethyl)thieno[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 157185275 |
| Molecular Formula | C17H16BN3OS2 |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylmethyl)-1-(dimethylboranylmethyl)thieno[3,4-d]pyridazin-4-one |
| SMILES | CB(C)Cc1nn(Cc2nc3ccccc3s2)c(=O)c2cscc12 |
| InChI | InChI=1S/C17H16BN3OS2/c1-18(2)7-14-11-9-23-10-12(11)17(22)21(20-14)8-16-19-13-5-3-4-6-15(13)24-16/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | XFBOHHWEYODHEG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|