C17H12F3N3O4 — CID 47771894
6-methyl-2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 47771894) has the molecular formula C17H12F3N3O4 and a molecular weight of 379.29 g/mol. Its IUPAC name is 6-methyl-2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 6-methyl-2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 47771894 |
| Molecular Formula | C17H12F3N3O4 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 6-methyl-2-[[4-nitro-2-(trifluoromethyl)phenoxy]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccc2nc(COc3ccc([N+](=O)[O-])cc3C(F)(F)F)cc(=O)n12 |
| InChI | InChI=1S/C17H12F3N3O4/c1-10-3-2-4-15-21-11(7-16(24)22(10)15)9-27-14-6-5-12(23(25)26)8-13(14)17(18,19)20/h2-8H,9H2,1H3 |
| InChIKey | PHCCCBVTOVNAAV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|