C16H15F3N4O4 — CID 135918110
6-[(2-methoxy-5-nitrophenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918110) has the molecular formula C16H15F3N4O4 and a molecular weight of 384.31 g/mol. Its IUPAC name is 6-[(2-methoxy-5-nitrophenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-methoxy-5-nitrophenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918110 |
| Molecular Formula | C16H15F3N4O4 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 6-[(2-methoxy-5-nitrophenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1CCc2nc(C(F)(F)F)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C16H15F3N4O4/c1-27-13-3-2-10(23(25)26)6-9(13)7-22-5-4-12-11(8-22)14(24)21-15(20-12)16(17,18)19/h2-3,6H,4-5,7-8H2,1H3,(H,20,21,24) |
| InChIKey | SVOWBMODCORMLK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|