About 2-ethylsulfonylbenzoic acid
2-ethylsulfonylbenzoic acid (PubChem CID 4777982) has the molecular formula C9H10O4S
and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-ethylsulfonylbenzoic acid.
Molecular Properties
| Compound Name | 2-ethylsulfonylbenzoic acid |
| PubChem CID | 4777982 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2-ethylsulfonylbenzoic acid |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C9H10O4S/c1-2-14(12,13)8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | AHYZXIUNHHXCHO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylsulfonylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonylbenzoic acid?
The IUPAC name of 2-ethylsulfonylbenzoic acid (CID 4777982) is 2-ethylsulfonylbenzoic acid.
What is the SMILES notation for 2-ethylsulfonylbenzoic acid?
The canonical SMILES for 2-ethylsulfonylbenzoic acid is CCS(=O)(=O)c1ccccc1C(=O)O.
What is the InChIKey of 2-ethylsulfonylbenzoic acid?
The InChIKey is AHYZXIUNHHXCHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4S/c1-2-14(12,13)8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3,(H,10,11).
What are the key properties of 2-ethylsulfonylbenzoic acid?
2-ethylsulfonylbenzoic acid has a molecular weight of 214.24 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonylbenzoic acid is sourced from PubChem (CID 4777982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).