About [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 4780391) has the molecular formula C16H14Cl2N2O5S
and a molecular weight of 417.27 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate.
Molecular Properties
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate |
| PubChem CID | 4780391 |
| Molecular Formula | C16H14Cl2N2O5S |
| Molecular Weight | 417.27 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)OCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C16H14Cl2N2O5S/c1-8(25-12-3-2-9(17)6-11(12)18)16(23)24-7-13(21)20-15-10(14(19)22)4-5-26-15/h2-6,8H,7H2,1H3,(H2,19,22)(H,20,21) |
| InChIKey | DQUVVVUUTPJJFU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate?
The IUPAC name of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate (CID 4780391) is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate.
What is the SMILES notation for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate?
The canonical SMILES for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate is CC(Oc1ccc(Cl)cc1Cl)C(=O)OCC(=O)Nc1sccc1C(N)=O.
What is the InChIKey of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate?
The InChIKey is DQUVVVUUTPJJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N2O5S/c1-8(25-12-3-2-9(17)6-11(12)18)16(23)24-7-13(21)20-15-10(14(19)22)4-5-26-15/h2-6,8H,7H2,1H3,(H2,19,22)(H,20,21).
What are the key properties of [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate?
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate has a molecular weight of 417.27 g/mol, XLogP of 3.10, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(2,4-dichlorophenoxy)propanoate is sourced from PubChem (CID 4780391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).