C16H17N3O2S2 — CID 47817437
5-(naphthalen-1-ylmethylsulfonyl)-N-propyl-1,3,4-thiadiazol-2-amine (PubChem CID 47817437) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 5-(naphthalen-1-ylmethylsulfonyl)-N-propyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(naphthalen-1-ylmethylsulfonyl)-N-propyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 47817437 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 5-(naphthalen-1-ylmethylsulfonyl)-N-propyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCNc1nnc(S(=O)(=O)Cc2cccc3ccccc23)s1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-2-10-17-15-18-19-16(22-15)23(20,21)11-13-8-5-7-12-6-3-4-9-14(12)13/h3-9H,2,10-11H2,1H3,(H,17,18) |
| InChIKey | JPKPETLMVMWDHN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |