C21H26N4O6S — CID 4788912
ethyl 5-propan-2-yl-2-[[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 4788912) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is ethyl 5-propan-2-yl-2-[[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-propan-2-yl-2-[[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4788912 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | ethyl 5-propan-2-yl-2-[[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)Nc2sc(C(C)C)cc2C(=O)OCC)c1=O |
| InChI | InChI=1S/C21H26N4O6S/c1-6-9-23-19(28)24(10-7-2)21(30)25(20(23)29)12-16(26)22-17-14(18(27)31-8-3)11-15(32-17)13(4)5/h6-7,11,13H,1-2,8-10,12H2,3-5H3,(H,22,26) |
| InChIKey | KPGJSOJMFSUTBB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|