C18H24N2O3S — CID 4791502
N-cyclohexyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 4791502) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-cyclohexyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | N-cyclohexyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4791502 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-cyclohexyl-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1cc(-c2csc(NC3CCCCC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H24N2O3S/c1-21-15-9-12(10-16(22-2)17(15)23-3)14-11-24-18(20-14)19-13-7-5-4-6-8-13/h9-11,13H,4-8H2,1-3H3,(H,19,20) |
| InChIKey | OAFFJWURAXUAAK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |