C24H27N5O3S2 — CID 4793478
2-[1-[[5-[(4-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4793478) has the molecular formula C24H27N5O3S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is 2-[1-[[5-[(4-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[1-[[5-[(4-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4793478 |
| Molecular Formula | C24H27N5O3S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[1-[[5-[(4-methoxyphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(OCc2nnc(SC(C)c3nc4sc5c(c4c(=O)[nH]3)CCC(C)C5)n2C)cc1 |
| InChI | InChI=1S/C24H27N5O3S2/c1-13-5-10-17-18(11-13)34-23-20(17)22(30)25-21(26-23)14(2)33-24-28-27-19(29(24)3)12-32-16-8-6-15(31-4)7-9-16/h6-9,13-14H,5,10-12H2,1-4H3,(H,25,26,30) |
| InChIKey | YOVRAZROBPHMEJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |