C22H19N3O5S — CID 4794693
3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(4-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 4794693) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(4-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4794693 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(4-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | COc1cc(C(=O)Nc2nc(C)cs2)cc(CN2C(=O)c3ccccc3C2=O)c1OC |
| InChI | InChI=1S/C22H19N3O5S/c1-12-11-31-22(23-12)24-19(26)13-8-14(18(30-3)17(9-13)29-2)10-25-20(27)15-6-4-5-7-16(15)21(25)28/h4-9,11H,10H2,1-3H3,(H,23,24,26) |
| InChIKey | HTVBMCMBESTSQZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|