C24H21N3O6 — CID 4792750
3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide (PubChem CID 4792750) has the molecular formula C24H21N3O6 and a molecular weight of 447.45 g/mol. Its IUPAC name is 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide.
| Compound Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide |
|---|---|
| PubChem CID | 4792750 |
| Molecular Formula | C24H21N3O6 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxy-N-(6-methoxy-3-pyridinyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(CN3C(=O)c4ccccc4C3=O)c(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C24H21N3O6/c1-31-19-11-14(22(28)26-16-8-9-20(32-2)25-12-16)10-15(21(19)33-3)13-27-23(29)17-6-4-5-7-18(17)24(27)30/h4-12H,13H2,1-3H3,(H,26,28) |
| InChIKey | FMVSGSHBMLYQGJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|