C27H30N2O7 — CID 17460073
[1-(azepan-1-yl)-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate (PubChem CID 17460073) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is [1-(azepan-1-yl)-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate.
| Compound Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 17460073 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | [1-(azepan-1-yl)-1-oxopropan-2-yl] 3-[(1,3-dioxoisoindol-2-yl)methyl]-4,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)OC(C)C(=O)N2CCCCCC2)cc(CN2C(=O)c3ccccc3C2=O)c1OC |
| InChI | InChI=1S/C27H30N2O7/c1-17(24(30)28-12-8-4-5-9-13-28)36-27(33)18-14-19(23(35-3)22(15-18)34-2)16-29-25(31)20-10-6-7-11-21(20)26(29)32/h6-7,10-11,14-15,17H,4-5,8-9,12-13,16H2,1-3H3 |
| InChIKey | JLZAOYJKMNAGQN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|