C21H27ClFN3O3S — CID 4800517
4-(tert-butylamino)-3-(tert-butylsulfamoyl)-N-(4-chloro-2-fluorophenyl)benzamide (PubChem CID 4800517) has the molecular formula C21H27ClFN3O3S and a molecular weight of 455.98 g/mol. Its IUPAC name is 4-(tert-butylamino)-3-(tert-butylsulfamoyl)-N-(4-chloro-2-fluorophenyl)benzamide.
| Compound Name | 4-(tert-butylamino)-3-(tert-butylsulfamoyl)-N-(4-chloro-2-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 4800517 |
| Molecular Formula | C21H27ClFN3O3S |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-(tert-butylamino)-3-(tert-butylsulfamoyl)-N-(4-chloro-2-fluorophenyl)benzamide |
| SMILES | CC(C)(C)Nc1ccc(C(=O)Nc2ccc(Cl)cc2F)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H27ClFN3O3S/c1-20(2,3)25-17-9-7-13(11-18(17)30(28,29)26-21(4,5)6)19(27)24-16-10-8-14(22)12-15(16)23/h7-12,25-26H,1-6H3,(H,24,27) |
| InChIKey | VDQYMMZHTVVZGL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |