C17H9F2N3OS — CID 4801011
3-cyano-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4801011) has the molecular formula C17H9F2N3OS and a molecular weight of 341.34 g/mol. Its IUPAC name is 3-cyano-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3-cyano-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4801011 |
| Molecular Formula | C17H9F2N3OS |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 3-cyano-N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2nc(-c3cc(F)ccc3F)cs2)c1 |
| InChI | InChI=1S/C17H9F2N3OS/c18-12-4-5-14(19)13(7-12)15-9-24-17(21-15)22-16(23)11-3-1-2-10(6-11)8-20/h1-7,9H,(H,21,22,23) |
| InChIKey | RROBJMVMSBXUBV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |